C17H12O4 — CID 42648414
8-methyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine-6,11-dione (PubChem CID 42648414) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 8-methyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine-6,11-dione.
| Compound Name | 8-methyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine-6,11-dione |
|---|---|
| PubChem CID | 42648414 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 8-methyl-2,3-dihydronaphtho[2,3-g][1,4]benzodioxine-6,11-dione |
| SMILES | Cc1ccc2c(c1)C(=O)c1cc3c(cc1C2=O)OCCO3 |
| InChI | InChI=1S/C17H12O4/c1-9-2-3-10-11(6-9)17(19)13-8-15-14(20-4-5-21-15)7-12(13)16(10)18/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | ONICPGVJAJODNY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|