About (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane
(1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane (PubChem CID 42648527) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane |
| PubChem CID | 42648527 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane |
| SMILES | C=C1CC(C)[C@@H]2COC(C)[C@@H]1C2 |
| InChI | InChI=1S/C11H18O/c1-7-4-8(2)11-5-10(7)6-12-9(11)3/h7,9-11H,2,4-6H2,1,3H3/t7?,9?,10-,11+/m0/s1 |
| InChIKey | CHLVZIDTMFMLMP-BHOWOBCZSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane?
The IUPAC name of (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane (CID 42648527) is (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane.
What is the SMILES notation for (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane?
The canonical SMILES for (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane is C=C1CC(C)[C@@H]2COC(C)[C@@H]1C2.
What is the InChIKey of (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane?
The InChIKey is CHLVZIDTMFMLMP-BHOWOBCZSA-N. The full InChI is InChI=1S/C11H18O/c1-7-4-8(2)11-5-10(7)6-12-9(11)3/h7,9-11H,2,4-6H2,1,3H3/t7?,9?,10-,11+/m0/s1.
What are the key properties of (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane?
(1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane has a molecular weight of 166.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-2,6-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonane is sourced from PubChem (CID 42648527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).