C17H23N3O5S — CID 42650428
1-(4-methoxyphenyl)-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 42650428) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(4-methoxyphenyl)-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42650428 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2CC(C(=O)N3CCN(S(C)(=O)=O)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O5S/c1-25-15-5-3-14(4-6-15)20-12-13(11-16(20)21)17(22)18-7-9-19(10-8-18)26(2,23)24/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | UFKKILJJGOPYFA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |