C17H26N2O4S — CID 42650571
6-hydroxy-4,4,6-trimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2-thione (PubChem CID 42650571) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 6-hydroxy-4,4,6-trimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2-thione.
| Compound Name | 6-hydroxy-4,4,6-trimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 42650571 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-hydroxy-4,4,6-trimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2-thione |
| SMILES | COc1cc(CN2C(=S)NC(C)(C)CC2(C)O)cc(OC)c1OC |
| InChI | InChI=1S/C17H26N2O4S/c1-16(2)10-17(3,20)19(15(24)18-16)9-11-7-12(21-4)14(23-6)13(8-11)22-5/h7-8,20H,9-10H2,1-6H3,(H,18,24) |
| InChIKey | IMKFTJZPFBXERP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|