C16H28N2O2 — CID 42650700
8a-hydroxy-1-propan-2-ylspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-one (PubChem CID 42650700) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 8a-hydroxy-1-propan-2-ylspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-one.
| Compound Name | 8a-hydroxy-1-propan-2-ylspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 42650700 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 8a-hydroxy-1-propan-2-ylspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-one |
| SMILES | CC(C)N1C(=O)NC2(CCCCC2)C2CCCCC21O |
| InChI | InChI=1S/C16H28N2O2/c1-12(2)18-14(19)17-15(9-5-3-6-10-15)13-8-4-7-11-16(13,18)20/h12-13,20H,3-11H2,1-2H3,(H,17,19) |
| InChIKey | MPMDAEGLRCXFPA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |