About 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone
2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone (PubChem CID 4265083) has the molecular formula C24H19BrN2O2S
and a molecular weight of 479.40 g/mol. Its IUPAC name is 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone.
Molecular Properties
| Compound Name | 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone |
| PubChem CID | 4265083 |
| Molecular Formula | C24H19BrN2O2S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone |
| SMILES | Cc1nc2sc(C(=O)c3ccccc3)c(N)c2c(C)c1CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H19BrN2O2S/c1-13-18(12-19(28)15-8-10-17(25)11-9-15)14(2)27-24-20(13)21(26)23(30-24)22(29)16-6-4-3-5-7-16/h3-11H,12,26H2,1-2H3 |
| InChIKey | ZPKUFOYVVTYVDV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone?
The IUPAC name of 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone (CID 4265083) is 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone.
What is the SMILES notation for 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone?
The canonical SMILES for 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone is Cc1nc2sc(C(=O)c3ccccc3)c(N)c2c(C)c1CC(=O)c1ccc(Br)cc1.
What is the InChIKey of 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone?
The InChIKey is ZPKUFOYVVTYVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19BrN2O2S/c1-13-18(12-19(28)15-8-10-17(25)11-9-15)14(2)27-24-20(13)21(26)23(30-24)22(29)16-6-4-3-5-7-16/h3-11H,12,26H2,1-2H3.
What are the key properties of 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone?
2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone has a molecular weight of 479.40 g/mol, XLogP of 5.91, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-2-benzoyl-4,6-dimethylthieno[2,3-b]pyridin-5-yl)-1-(4-bromophenyl)ethanone is sourced from PubChem (CID 4265083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).