C22H30N4O3 — CID 42651044
2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid (PubChem CID 42651044) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid.
| Compound Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42651044 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)C(c1c[nH]c2ccccc12)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H30N4O3/c27-20(25-9-5-1-2-6-10-25)16-24-11-13-26(14-12-24)21(22(28)29)18-15-23-19-8-4-3-7-17(18)19/h3-4,7-8,15,21,23H,1-2,5-6,9-14,16H2,(H,28,29) |
| InChIKey | DJOFTCBHMMPSPY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |