C18H18N2O3 — CID 42651384
N-(4-hydroxyphenyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide (PubChem CID 42651384) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42651384 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(4-hydroxyphenyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
| SMILES | CN1C(=O)CC(C(=O)Nc2ccc(O)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c1-20-16(22)11-15(17(20)12-5-3-2-4-6-12)18(23)19-13-7-9-14(21)10-8-13/h2-10,15,17,21H,11H2,1H3,(H,19,23) |
| InChIKey | LNBCWBZZQJTRDV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|