C20H23N3O5S — CID 42652015
1-(3-methoxyphenyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 42652015) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42652015 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)CC2=O)c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-28-17-4-2-3-16(12-17)23-13-15(11-19(23)24)20(25)22-10-9-14-5-7-18(8-6-14)29(21,26)27/h2-8,12,15H,9-11,13H2,1H3,(H,22,25)(H2,21,26,27) |
| InChIKey | AUFSHZQUQPCKEY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |