C20H23N3O5S2 — CID 42652474
1-(3-methoxyphenyl)-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 42652474) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42652474 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | COc1cccc(N2CC(C(=O)N3CCN(S(=O)(=O)c4cccs4)CC3)CC2=O)c1 |
| InChI | InChI=1S/C20H23N3O5S2/c1-28-17-5-2-4-16(13-17)23-14-15(12-18(23)24)20(25)21-7-9-22(10-8-21)30(26,27)19-6-3-11-29-19/h2-6,11,13,15H,7-10,12,14H2,1H3 |
| InChIKey | LPLYALSWLNGKJM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |