C19H20N2O2 — CID 42653944
2-(7-methoxyindol-1-yl)-N-(1-phenylethyl)acetamide (PubChem CID 42653944) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(7-methoxyindol-1-yl)-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(7-methoxyindol-1-yl)-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 42653944 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(7-methoxyindol-1-yl)-N-(1-phenylethyl)acetamide |
| SMILES | COc1cccc2ccn(CC(=O)NC(C)c3ccccc3)c12 |
| InChI | InChI=1S/C19H20N2O2/c1-14(15-7-4-3-5-8-15)20-18(22)13-21-12-11-16-9-6-10-17(23-2)19(16)21/h3-12,14H,13H2,1-2H3,(H,20,22) |
| InChIKey | OXGRNGFFEFAQDE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |