C18H21N5O2S — CID 42654087
2-[[12-ethyl-4-(furan-2-yl)-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]butan-1-ol (PubChem CID 42654087) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-[[12-ethyl-4-(furan-2-yl)-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]butan-1-ol.
| Compound Name | 2-[[12-ethyl-4-(furan-2-yl)-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 42654087 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[[12-ethyl-4-(furan-2-yl)-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]butan-1-ol |
| SMILES | CCc1c(C)sc2nc(NC(CC)CO)n3nc(-c4ccco4)nc3c12 |
| InChI | InChI=1S/C18H21N5O2S/c1-4-11(9-24)19-18-21-17-14(12(5-2)10(3)26-17)16-20-15(22-23(16)18)13-7-6-8-25-13/h6-8,11,24H,4-5,9H2,1-3H3,(H,19,21) |
| InChIKey | SODADBGTBCKTSG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |