C16H17N5O2S — CID 42654270
1-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]propan-2-ol (PubChem CID 42654270) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]propan-2-ol.
| Compound Name | 1-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 42654270 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]propan-2-ol |
| SMILES | Cc1sc2nc(NCC(C)O)n3nc(-c4ccco4)nc3c2c1C |
| InChI | InChI=1S/C16H17N5O2S/c1-8(22)7-17-16-19-15-12(9(2)10(3)24-15)14-18-13(20-21(14)16)11-5-4-6-23-11/h4-6,8,22H,7H2,1-3H3,(H,17,19) |
| InChIKey | RUZCZLQXGBMKLV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |