C14H14N4O — CID 42656765
N,5-dimethyl-1-phenyl-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide (PubChem CID 42656765) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is N,5-dimethyl-1-phenyl-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N,5-dimethyl-1-phenyl-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42656765 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N,5-dimethyl-1-phenyl-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide |
| SMILES | C#CCN(C)C(=O)c1nc(C)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H14N4O/c1-4-10-17(3)14(19)13-15-11(2)18(16-13)12-8-6-5-7-9-12/h1,5-9H,10H2,2-3H3 |
| InChIKey | HAOSMCQBXJCSSD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|