About N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide
N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 42656769) has the molecular formula C14H18N4O
and a molecular weight of 258.32 g/mol. Its IUPAC name is N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 42656769 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(-n2cnc(C(=O)N(C)C(C)C)n2)cc1 |
| InChI | InChI=1S/C14H18N4O/c1-10(2)17(4)14(19)13-15-9-18(16-13)12-7-5-11(3)6-8-12/h5-10H,1-4H3 |
| InChIKey | QGFIFSNWVFTYOE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide?
The IUPAC name of N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide (CID 42656769) is N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide is Cc1ccc(-n2cnc(C(=O)N(C)C(C)C)n2)cc1.
What is the InChIKey of N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide?
The InChIKey is QGFIFSNWVFTYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O/c1-10(2)17(4)14(19)13-15-9-18(16-13)12-7-5-11(3)6-8-12/h5-10H,1-4H3.
What are the key properties of N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide?
N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide has a molecular weight of 258.32 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-methylphenyl)-N-propan-2-yl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 42656769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).