About [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate
[2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate (PubChem CID 42658953) has the molecular formula C30H32BrN3O2
and a molecular weight of 546.51 g/mol. Its IUPAC name is [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate.
Molecular Properties
| Compound Name | [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate |
| PubChem CID | 42658953 |
| Molecular Formula | C30H32BrN3O2 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)Oc2ccccc2-c2nc3ccc(Br)cn3c2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C30H32BrN3O2/c1-2-3-9-21-14-16-22(17-15-21)30(35)36-26-13-8-7-12-25(26)28-29(32-24-10-5-4-6-11-24)34-20-23(31)18-19-27(34)33-28/h7-8,12-20,24,32H,2-6,9-11H2,1H3 |
| InChIKey | GRJWYHSFZYATCN-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate?
The IUPAC name of [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate (CID 42658953) is [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate.
What is the SMILES notation for [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate?
The canonical SMILES for [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate is CCCCc1ccc(C(=O)Oc2ccccc2-c2nc3ccc(Br)cn3c2NC2CCCCC2)cc1.
What is the InChIKey of [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate?
The InChIKey is GRJWYHSFZYATCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32BrN3O2/c1-2-3-9-21-14-16-22(17-15-21)30(35)36-26-13-8-7-12-25(26)28-29(32-24-10-5-4-6-11-24)34-20-23(31)18-19-27(34)33-28/h7-8,12-20,24,32H,2-6,9-11H2,1H3.
What are the key properties of [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate?
[2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate has a molecular weight of 546.51 g/mol, XLogP of 8.07, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-butylbenzoate is sourced from PubChem (CID 42658953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).