C31H41N3O4 — CID 42661004
ethyl 6-[4-(nonanoylamino)phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661004) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is ethyl 6-[4-(nonanoylamino)phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[4-(nonanoylamino)phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661004 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | ethyl 6-[4-(nonanoylamino)phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCCCCCC(=O)Nc1ccc(C2NC(=O)N(CCC)C(c3ccccc3)=C2C(=O)OCC)cc1 |
| InChI | InChI=1S/C31H41N3O4/c1-4-7-8-9-10-14-17-26(35)32-25-20-18-23(19-21-25)28-27(30(36)38-6-3)29(24-15-12-11-13-16-24)34(22-5-2)31(37)33-28/h11-13,15-16,18-21,28H,4-10,14,17,22H2,1-3H3,(H,32,35)(H,33,37) |
| InChIKey | TZRCOEAFGLNVEH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|