C19H15N5O4 — CID 4266153
N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide (PubChem CID 4266153) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4266153 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[[1-(cyanomethyl)indol-3-yl]methylideneamino]-2-(2-nitrophenoxy)acetamide |
| SMILES | N#CCn1cc(C=NNC(=O)COc2ccccc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C19H15N5O4/c20-9-10-23-12-14(15-5-1-2-6-16(15)23)11-21-22-19(25)13-28-18-8-4-3-7-17(18)24(26)27/h1-8,11-12H,10,13H2,(H,22,25) |
| InChIKey | UXTOKHJVYHXJOX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|