C34H52ClN3O2 — CID 42664024
N-butan-2-yl-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]decanamide (PubChem CID 42664024) has the molecular formula C34H52ClN3O2 and a molecular weight of 570.26 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]decanamide.
| Compound Name | N-butan-2-yl-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 42664024 |
| Molecular Formula | C34H52ClN3O2 |
| Molecular Weight | 570.26 g/mol |
| Exact Mass | 569.37 |
| IUPAC Name | N-butan-2-yl-N-[2-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl-cyclohexylamino]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(CC(=O)N(Cc1cccn1Cc1ccccc1Cl)C1CCCCC1)C(C)CC |
| InChI | InChI=1S/C34H52ClN3O2/c1-4-6-7-8-9-10-14-23-33(39)37(28(3)5-2)27-34(40)38(30-19-12-11-13-20-30)26-31-21-17-24-36(31)25-29-18-15-16-22-32(29)35/h15-18,21-22,24,28,30H,4-14,19-20,23,25-27H2,1-3H3 |
| InChIKey | WCAZLLCYNZUDAE-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.26 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|