C27H26N4O2 — CID 4266456
14-(2-morpholin-4-ylethyl)-11-phenyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-imine (PubChem CID 4266456) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 14-(2-morpholin-4-ylethyl)-11-phenyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-imine.
| Compound Name | 14-(2-morpholin-4-ylethyl)-11-phenyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-imine |
|---|---|
| PubChem CID | 4266456 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 14-(2-morpholin-4-ylethyl)-11-phenyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-imine |
| SMILES | [H]/N=c1/c2c(ncn1CCN1CCOCC1)Oc1c(ccc3ccccc13)C2c1ccccc1 |
| InChI | InChI=1S/C27H26N4O2/c28-26-24-23(20-7-2-1-3-8-20)22-11-10-19-6-4-5-9-21(19)25(22)33-27(24)29-18-31(26)13-12-30-14-16-32-17-15-30/h1-11,18,23,28H,12-17H2/b28-26- |
| InChIKey | PIJBYDDOCXHZFH-SGEDCAFJSA-N |
| XLogP | 4.13 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |