C32H29N3O2S — CID 42665067
3-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]-N-(3,3-diphenylpropyl)-4-methylbenzamide (PubChem CID 42665067) has the molecular formula C32H29N3O2S and a molecular weight of 519.67 g/mol. Its IUPAC name is 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]-N-(3,3-diphenylpropyl)-4-methylbenzamide.
| Compound Name | 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]-N-(3,3-diphenylpropyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 42665067 |
| Molecular Formula | C32H29N3O2S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]-N-(3,3-diphenylpropyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCC(c2ccccc2)c2ccccc2)cc1Oc1nc(Cc2ccccc2)ns1 |
| InChI | InChI=1S/C32H29N3O2S/c1-23-17-18-27(22-29(23)37-32-34-30(35-38-32)21-24-11-5-2-6-12-24)31(36)33-20-19-28(25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-18,22,28H,19-21H2,1H3,(H,33,36) |
| InChIKey | GJFVHKGDIWHMHO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |