About N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine
N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine (PubChem CID 4266546) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 4266546 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCNc1n[nH]c(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H16N4/c1-2-3-9-13-12-14-11(15-16-12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H2,13,14,15,16) |
| InChIKey | RXZHSYKVQJTAIL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine (CID 4266546) is N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine is CCCCNc1n[nH]c(-c2ccccc2)n1.
What is the InChIKey of N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine?
The InChIKey is RXZHSYKVQJTAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-2-3-9-13-12-14-11(15-16-12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H2,13,14,15,16).
What are the key properties of N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine?
N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine has a molecular weight of 216.29 g/mol, XLogP of 2.68, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-phenyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 4266546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).