About 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine
4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 42667796) has the molecular formula C17H19ClN6
and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 42667796 |
| Molecular Formula | C17H19ClN6 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Cn1nc2nc(N3CCCCC3)nc(-c3ccccc3Cl)c2c1N |
| InChI | InChI=1S/C17H19ClN6/c1-23-15(19)13-14(11-7-3-4-8-12(11)18)20-17(21-16(13)22-23)24-9-5-2-6-10-24/h3-4,7-8H,2,5-6,9-10,19H2,1H3 |
| InChIKey | TYSHFIFMMTUSQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine (CID 42667796) is 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine is Cn1nc2nc(N3CCCCC3)nc(-c3ccccc3Cl)c2c1N.
What is the InChIKey of 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is TYSHFIFMMTUSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN6/c1-23-15(19)13-14(11-7-3-4-8-12(11)18)20-17(21-16(13)22-23)24-9-5-2-6-10-24/h3-4,7-8H,2,5-6,9-10,19H2,1H3.
What are the key properties of 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine?
4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 342.83 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-2-methyl-6-piperidin-1-ylpyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 42667796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).