C22H24N6O2 — CID 42668216
2-benzyl-6-N-(2-methoxyethyl)-4-(2-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 42668216) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-benzyl-6-N-(2-methoxyethyl)-4-(2-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 2-benzyl-6-N-(2-methoxyethyl)-4-(2-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 42668216 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-benzyl-6-N-(2-methoxyethyl)-4-(2-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | COCCNc1nc(-c2ccccc2OC)c2c(N)n(Cc3ccccc3)nc2n1 |
| InChI | InChI=1S/C22H24N6O2/c1-29-13-12-24-22-25-19(16-10-6-7-11-17(16)30-2)18-20(23)28(27-21(18)26-22)14-15-8-4-3-5-9-15/h3-11H,12-14,23H2,1-2H3,(H,24,26,27) |
| InChIKey | OPJSAIRVWZBDHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|