C20H18F2N6O — CID 42668772
4-(2,4-difluorophenyl)-2-methyl-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 42668772) has the molecular formula C20H18F2N6O and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-methyl-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 4-(2,4-difluorophenyl)-2-methyl-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 42668772 |
| Molecular Formula | C20H18F2N6O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-methyl-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | Cn1nc2nc(NCCOc3ccccc3)nc(-c3ccc(F)cc3F)c2c1N |
| InChI | InChI=1S/C20H18F2N6O/c1-28-18(23)16-17(14-8-7-12(21)11-15(14)22)25-20(26-19(16)27-28)24-9-10-29-13-5-3-2-4-6-13/h2-8,11H,9-10,23H2,1H3,(H,24,26,27) |
| InChIKey | DDBYXFUNODBLRP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|