About 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine
4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 42668905) has the molecular formula C22H21FN6O
and a molecular weight of 404.45 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 42668905 |
| Molecular Formula | C22H21FN6O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Cc1cccc(-n2nc3nc(N4CCOCC4)nc(-c4cccc(F)c4)c3c2N)c1 |
| InChI | InChI=1S/C22H21FN6O/c1-14-4-2-7-17(12-14)29-20(24)18-19(15-5-3-6-16(23)13-15)25-22(26-21(18)27-29)28-8-10-30-11-9-28/h2-7,12-13H,8-11,24H2,1H3 |
| InChIKey | KFFZPERJMYHIFP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine (CID 42668905) is 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine is Cc1cccc(-n2nc3nc(N4CCOCC4)nc(-c4cccc(F)c4)c3c2N)c1.
What is the InChIKey of 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is KFFZPERJMYHIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN6O/c1-14-4-2-7-17(12-14)29-20(24)18-19(15-5-3-6-16(23)13-15)25-22(26-21(18)27-29)28-8-10-30-11-9-28/h2-7,12-13H,8-11,24H2,1H3.
What are the key properties of 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine?
4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 404.45 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-2-(3-methylphenyl)-6-morpholin-4-ylpyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 42668905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).