About ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate
ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate (PubChem CID 42669792) has the molecular formula C17H24F3N3O3
and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate |
| PubChem CID | 42669792 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCCc1c(C(=O)N2CCCC(C(=O)OCC)C2)cnn1CC(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O3/c1-3-6-14-13(9-21-23(14)11-17(18,19)20)15(24)22-8-5-7-12(10-22)16(25)26-4-2/h9,12H,3-8,10-11H2,1-2H3 |
| InChIKey | XYPAMGMHROLYSJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate?
The IUPAC name of ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate (CID 42669792) is ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate is CCCc1c(C(=O)N2CCCC(C(=O)OCC)C2)cnn1CC(F)(F)F.
What is the InChIKey of ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate?
The InChIKey is XYPAMGMHROLYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F3N3O3/c1-3-6-14-13(9-21-23(14)11-17(18,19)20)15(24)22-8-5-7-12(10-22)16(25)26-4-2/h9,12H,3-8,10-11H2,1-2H3.
What are the key properties of ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate?
ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate has a molecular weight of 375.39 g/mol, XLogP of 2.81, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[5-propyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]piperidine-3-carboxylate is sourced from PubChem (CID 42669792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).