C22H23N5O2 — CID 42670736
2-(3-methylphenyl)-4-morpholin-4-yl-N-(pyridin-4-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 42670736) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(3-methylphenyl)-4-morpholin-4-yl-N-(pyridin-4-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-methylphenyl)-4-morpholin-4-yl-N-(pyridin-4-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 42670736 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(3-methylphenyl)-4-morpholin-4-yl-N-(pyridin-4-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(-c2ncc(C(=O)NCc3ccncc3)c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-16-3-2-4-18(13-16)20-24-15-19(21(26-20)27-9-11-29-12-10-27)22(28)25-14-17-5-7-23-8-6-17/h2-8,13,15H,9-12,14H2,1H3,(H,25,28) |
| InChIKey | NUKQRYJUZUMJBF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |