C23H30N4O2 — CID 42670869
[4-[cyclohexyl(methyl)amino]-2-(3-methylphenyl)pyrimidin-5-yl]-morpholin-4-ylmethanone (PubChem CID 42670869) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[cyclohexyl(methyl)amino]-2-(3-methylphenyl)pyrimidin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[cyclohexyl(methyl)amino]-2-(3-methylphenyl)pyrimidin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42670869 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [4-[cyclohexyl(methyl)amino]-2-(3-methylphenyl)pyrimidin-5-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(-c2ncc(C(=O)N3CCOCC3)c(N(C)C3CCCCC3)n2)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-17-7-6-8-18(15-17)21-24-16-20(23(28)27-11-13-29-14-12-27)22(25-21)26(2)19-9-4-3-5-10-19/h6-8,15-16,19H,3-5,9-14H2,1-2H3 |
| InChIKey | IODMJRDJBCNBIJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |