About 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide
5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide (PubChem CID 42671656) has the molecular formula C22H34N4O2
and a molecular weight of 386.54 g/mol. Its IUPAC name is 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
| PubChem CID | 42671656 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(N)ccc1N1CCCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-3-24(4-2)22(28)19-16-18(23)10-11-20(19)25-12-7-13-26(15-14-25)21(27)17-8-5-6-9-17/h10-11,16-17H,3-9,12-15,23H2,1-2H3 |
| InChIKey | SHGWJAOFZPPDBQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide?
The IUPAC name of 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide (CID 42671656) is 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide.
What is the SMILES notation for 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide?
The canonical SMILES for 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide is CCN(CC)C(=O)c1cc(N)ccc1N1CCCN(C(=O)C2CCCC2)CC1.
What is the InChIKey of 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide?
The InChIKey is SHGWJAOFZPPDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N4O2/c1-3-24(4-2)22(28)19-16-18(23)10-11-20(19)25-12-7-13-26(15-14-25)21(27)17-8-5-6-9-17/h10-11,16-17H,3-9,12-15,23H2,1-2H3.
What are the key properties of 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide?
5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide has a molecular weight of 386.54 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[4-(cyclopentanecarbonyl)-1,4-diazepan-1-yl]-N,N-diethylbenzamide is sourced from PubChem (CID 42671656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).