C22H28N2O6 — CID 42672885
methyl 4-[2-[(4-methoxybenzoyl)-(3-methoxypropyl)amino]acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42672885) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl 4-[2-[(4-methoxybenzoyl)-(3-methoxypropyl)amino]acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-methoxybenzoyl)-(3-methoxypropyl)amino]acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42672885 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | methyl 4-[2-[(4-methoxybenzoyl)-(3-methoxypropyl)amino]acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COCCCN(CC(=O)c1c(C)[nH]c(C(=O)OC)c1C)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28N2O6/c1-14-19(15(2)23-20(14)22(27)30-5)18(25)13-24(11-6-12-28-3)21(26)16-7-9-17(29-4)10-8-16/h7-10,23H,6,11-13H2,1-5H3 |
| InChIKey | PUFYNUVOOAWULX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|