About 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one
1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one (PubChem CID 4267368) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol.
Molecular Properties
| Compound Name | 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one |
| PubChem CID | 4267368 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(CCNC23CCCC3)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O/c1-18-13-7-3-2-6-12(13)16(14(18)19)10-11-17-15(16)8-4-5-9-15/h2-3,6-7,17H,4-5,8-11H2,1H3 |
| InChIKey | QXWBITMBUVPYMS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one?
The IUPAC name of 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one (CID 4267368) is not available.
What is the SMILES notation for 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one?
The canonical SMILES for 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one is CN1C(=O)C2(CCNC23CCCC3)c2ccccc21.
What is the InChIKey of 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one?
The InChIKey is QXWBITMBUVPYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-18-13-7-3-2-6-12(13)16(14(18)19)10-11-17-15(16)8-4-5-9-15/h2-3,6-7,17H,4-5,8-11H2,1H3.
What are the key properties of 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one?
1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one has a molecular weight of 256.35 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1''-methyldispiro[cyclopentane-1,2'-pyrrolidine-3',3''-indol]-2''(1''H)-one is sourced from PubChem (CID 4267368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).