About [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate (PubChem CID 4267633) has the molecular formula C18H18N2O7S
and a molecular weight of 406.42 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate.
Molecular Properties
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate |
| PubChem CID | 4267633 |
| Molecular Formula | C18H18N2O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate |
| SMILES | CC(OC(=O)c1cccc(NS(C)(=O)=O)c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O7S/c1-11(17(21)19-13-6-7-15-16(9-13)26-10-25-15)27-18(22)12-4-3-5-14(8-12)20-28(2,23)24/h3-9,11,20H,10H2,1-2H3,(H,19,21) |
| InChIKey | GQTZSMOGHPNFOJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate?
The IUPAC name of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate (CID 4267633) is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate.
What is the SMILES notation for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate?
The canonical SMILES for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate is CC(OC(=O)c1cccc(NS(C)(=O)=O)c1)C(=O)Nc1ccc2c(c1)OCO2.
What is the InChIKey of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate?
The InChIKey is GQTZSMOGHPNFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O7S/c1-11(17(21)19-13-6-7-15-16(9-13)26-10-25-15)27-18(22)12-4-3-5-14(8-12)20-28(2,23)24/h3-9,11,20H,10H2,1-2H3,(H,19,21).
What are the key properties of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate?
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate has a molecular weight of 406.42 g/mol, XLogP of 1.97, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 3-(methanesulfonamido)benzoate is sourced from PubChem (CID 4267633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).