C22H30N2O5S — CID 42677575
methyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42677575) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is methyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42677575 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | methyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCOCCCN(C(=O)c1cccs1)C(C)C(=O)c1c(C)c(C(=O)OC)n(C)c1C |
| InChI | InChI=1S/C22H30N2O5S/c1-7-29-12-9-11-24(21(26)17-10-8-13-30-17)16(4)20(25)18-14(2)19(22(27)28-6)23(5)15(18)3/h8,10,13,16H,7,9,11-12H2,1-6H3 |
| InChIKey | NPDZFVXXAZNXMN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|