About 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea
1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea (PubChem CID 4267802) has the molecular formula C13H15ClN4OS
and a molecular weight of 310.81 g/mol. Its IUPAC name is 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea |
| PubChem CID | 4267802 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea |
| SMILES | CCCCc1nnc(NC(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H15ClN4OS/c1-2-3-4-11-17-18-13(20-11)16-12(19)15-10-7-5-9(14)6-8-10/h5-8H,2-4H2,1H3,(H2,15,16,18,19) |
| InChIKey | QMHGYJXNPPROST-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea?
The IUPAC name of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea (CID 4267802) is 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea.
What is the SMILES notation for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea?
The canonical SMILES for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea is CCCCc1nnc(NC(=O)Nc2ccc(Cl)cc2)s1.
What is the InChIKey of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea?
The InChIKey is QMHGYJXNPPROST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN4OS/c1-2-3-4-11-17-18-13(20-11)16-12(19)15-10-7-5-9(14)6-8-10/h5-8H,2-4H2,1H3,(H2,15,16,18,19).
What are the key properties of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea?
1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea has a molecular weight of 310.81 g/mol, XLogP of 4.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-chlorophenyl)urea is sourced from PubChem (CID 4267802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).