C23H23ClN6O — CID 42679070
4-chloro-N-[2-[[3,6-dimethyl-1-(2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 42679070) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 4-chloro-N-[2-[[3,6-dimethyl-1-(2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[3,6-dimethyl-1-(2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 42679070 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-chloro-N-[2-[[3,6-dimethyl-1-(2-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccc(Cl)cc2)c2c(C)nn(-c3ccccc3C)c2n1 |
| InChI | InChI=1S/C23H23ClN6O/c1-14-6-4-5-7-19(14)30-22-20(15(2)29-30)21(27-16(3)28-22)25-12-13-26-23(31)17-8-10-18(24)11-9-17/h4-11H,12-13H2,1-3H3,(H,26,31)(H,25,27,28) |
| InChIKey | PAXCFLGQNAGUKU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|