C24H33N5O7 — CID 4267996
3-[7-[3-(dimethylamino)propyl]-3-methyl-2,6-dioxopurin-1-yl]propyl 3,4,5-trimethoxybenzoate (PubChem CID 4267996) has the molecular formula C24H33N5O7 and a molecular weight of 503.56 g/mol. Its IUPAC name is 3-[7-[3-(dimethylamino)propyl]-3-methyl-2,6-dioxopurin-1-yl]propyl 3,4,5-trimethoxybenzoate.
| Compound Name | 3-[7-[3-(dimethylamino)propyl]-3-methyl-2,6-dioxopurin-1-yl]propyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 4267996 |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3-[7-[3-(dimethylamino)propyl]-3-methyl-2,6-dioxopurin-1-yl]propyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCn2c(=O)c3c(ncn3CCCN(C)C)n(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H33N5O7/c1-26(2)9-7-10-28-15-25-21-19(28)22(30)29(24(32)27(21)3)11-8-12-36-23(31)16-13-17(33-4)20(35-6)18(14-16)34-5/h13-15H,7-12H2,1-6H3 |
| InChIKey | XPTMLGWHWQHKBA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 119.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|