C25H24FN3O3 — CID 42680250
1-(4-fluorobenzoyl)-4-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 42680250) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-4-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-4-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42680250 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-(4-fluorobenzoyl)-4-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(C2CN(C(=O)c3ccc(F)cc3)CC2C(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H24FN3O3/c1-32-21-11-7-17(8-12-21)22-15-29(25(31)18-5-9-19(26)10-6-18)16-23(22)24(30)28-14-20-4-2-3-13-27-20/h2-13,22-23H,14-16H2,1H3,(H,28,30) |
| InChIKey | BHLSWWPAMWAGDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |