C20H22N2O3S — CID 42681016
N-cyclopropyl-4-(2-methoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxamide (PubChem CID 42681016) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-cyclopropyl-4-(2-methoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-(2-methoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681016 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-cyclopropyl-4-(2-methoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1C1CN(C(=O)c2cccs2)CC1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H22N2O3S/c1-25-17-6-3-2-5-14(17)15-11-22(20(24)18-7-4-10-26-18)12-16(15)19(23)21-13-8-9-13/h2-7,10,13,15-16H,8-9,11-12H2,1H3,(H,21,23) |
| InChIKey | SNGZUBQGWDVGFK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |