C23H26N2O6S2 — CID 42682611
N-[[2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 42682611) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-[[2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[[2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 42682611 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[[2-[(2,6-dimethoxyphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(Cc1csc(COc2c(OC)cccc2OC)n1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H26N2O6S2/c1-5-13-25(33(26,27)19-11-9-18(28-2)10-12-19)14-17-16-32-22(24-17)15-31-23-20(29-3)7-6-8-21(23)30-4/h5-12,16H,1,13-15H2,2-4H3 |
| InChIKey | BLUXNHYZNQQELZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|