C21H23ClN2O3 — CID 42682810
methyl 4-[[4-(3-chloro-4-methylphenyl)-2-methyl-3-oxopiperazin-1-yl]methyl]benzoate (PubChem CID 42682810) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is methyl 4-[[4-(3-chloro-4-methylphenyl)-2-methyl-3-oxopiperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(3-chloro-4-methylphenyl)-2-methyl-3-oxopiperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 42682810 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl 4-[[4-(3-chloro-4-methylphenyl)-2-methyl-3-oxopiperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCN(c3ccc(C)c(Cl)c3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-14-4-9-18(12-19(14)22)24-11-10-23(15(2)20(24)25)13-16-5-7-17(8-6-16)21(26)27-3/h4-9,12,15H,10-11,13H2,1-3H3 |
| InChIKey | LCZKJKVQPCWJCY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |