C30H31NO4S2 — CID 4268285
3-benzyl-5-[[4-[3-(3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4268285) has the molecular formula C30H31NO4S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is 3-benzyl-5-[[4-[3-(3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-[[4-[3-(3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4268285 |
| Molecular Formula | C30H31NO4S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-benzyl-5-[[4-[3-(3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C=C2SC(=S)N(Cc3ccccc3)C2=O)ccc1OCCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C30H31NO4S2/c1-4-33-27-18-24(19-28-29(32)31(30(36)37-28)20-23-9-6-5-7-10-23)11-12-26(27)35-14-8-13-34-25-16-21(2)15-22(3)17-25/h5-7,9-12,15-19H,4,8,13-14,20H2,1-3H3 |
| InChIKey | ZPBAHWHAOUVGND-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|