About N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide
N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide (PubChem CID 42686101) has the molecular formula C19H16ClF2N3O
and a molecular weight of 375.81 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide |
| PubChem CID | 42686101 |
| Molecular Formula | C19H16ClF2N3O |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide |
| SMILES | CCCc1[nH]nc(-c2cccc(Cl)c2)c1NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H16ClF2N3O/c1-2-4-16-18(17(25-24-16)11-5-3-6-12(20)9-11)23-19(26)14-8-7-13(21)10-15(14)22/h3,5-10H,2,4H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | AYUNQJMUGMFYJM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide?
The IUPAC name of N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide (CID 42686101) is N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide.
What is the SMILES notation for N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide?
The canonical SMILES for N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide is CCCc1[nH]nc(-c2cccc(Cl)c2)c1NC(=O)c1ccc(F)cc1F.
What is the InChIKey of N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide?
The InChIKey is AYUNQJMUGMFYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClF2N3O/c1-2-4-16-18(17(25-24-16)11-5-3-6-12(20)9-11)23-19(26)14-8-7-13(21)10-15(14)22/h3,5-10H,2,4H2,1H3,(H,23,26)(H,24,25).
What are the key properties of N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide?
N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide has a molecular weight of 375.81 g/mol, XLogP of 5.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-2,4-difluorobenzamide is sourced from PubChem (CID 42686101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).