About N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide
N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide (PubChem CID 42686209) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide |
| PubChem CID | 42686209 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide |
| SMILES | CCCc1[nH]nc(-c2ccc(C)cc2C)c1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C20H27N3O/c1-4-7-17-19(21-20(24)15-8-5-6-9-15)18(23-22-17)16-11-10-13(2)12-14(16)3/h10-12,15H,4-9H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | VTIRAOBAENEGSG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide?
The IUPAC name of N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide (CID 42686209) is N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide.
What is the SMILES notation for N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide?
The canonical SMILES for N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide is CCCc1[nH]nc(-c2ccc(C)cc2C)c1NC(=O)C1CCCC1.
What is the InChIKey of N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide?
The InChIKey is VTIRAOBAENEGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-4-7-17-19(21-20(24)15-8-5-6-9-15)18(23-22-17)16-11-10-13(2)12-14(16)3/h10-12,15H,4-9H2,1-3H3,(H,21,24)(H,22,23).
What are the key properties of N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide?
N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide has a molecular weight of 325.46 g/mol, XLogP of 4.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,4-dimethylphenyl)-5-propyl-1H-pyrazol-4-yl]cyclopentanecarboxamide is sourced from PubChem (CID 42686209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).