C15H18FN3O — CID 42686254
N-[5-ethyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide (PubChem CID 42686254) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[5-ethyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[5-ethyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42686254 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[5-ethyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide |
| SMILES | CCc1[nH]nc(-c2cccc(F)c2)c1NC(=O)C(C)C |
| InChI | InChI=1S/C15H18FN3O/c1-4-12-14(17-15(20)9(2)3)13(19-18-12)10-6-5-7-11(16)8-10/h5-9H,4H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | GQITXAIVVKGQIX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |