C22H25N3O3 — CID 42686366
2-(3-methoxyphenyl)-N-[3-[2-(4-methoxyphenyl)ethyl]-5-methyl-1H-pyrazol-4-yl]acetamide (PubChem CID 42686366) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[3-[2-(4-methoxyphenyl)ethyl]-5-methyl-1H-pyrazol-4-yl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[3-[2-(4-methoxyphenyl)ethyl]-5-methyl-1H-pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 42686366 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[3-[2-(4-methoxyphenyl)ethyl]-5-methyl-1H-pyrazol-4-yl]acetamide |
| SMILES | COc1ccc(CCc2n[nH]c(C)c2NC(=O)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-15-22(23-21(26)14-17-5-4-6-19(13-17)28-3)20(25-24-15)12-9-16-7-10-18(27-2)11-8-16/h4-8,10-11,13H,9,12,14H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | YTIYDZRJLZBAMT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |