C19H14F4N4O2S — CID 42688003
[3-[(2-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 42688003) has the molecular formula C19H14F4N4O2S and a molecular weight of 438.41 g/mol. Its IUPAC name is [3-[(2-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-[(2-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 42688003 |
| Molecular Formula | C19H14F4N4O2S |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [3-[(2-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCSc2nnc(COc3ccccc3F)n21 |
| InChI | InChI=1S/C19H14F4N4O2S/c20-14-7-3-4-8-15(14)29-11-16-24-25-18-27(16)26(9-10-30-18)17(28)12-5-1-2-6-13(12)19(21,22)23/h1-8H,9-11H2 |
| InChIKey | ODOGCVRAYWQSLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |