C21H21FN4O2S — CID 42688009
1-[3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylbutan-1-one (PubChem CID 42688009) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylbutan-1-one.
| Compound Name | 1-[3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 42688009 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[3-[(3-fluorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylbutan-1-one |
| SMILES | CCC(C(=O)N1CCSc2nnc(COc3cccc(F)c3)n21)c1ccccc1 |
| InChI | InChI=1S/C21H21FN4O2S/c1-2-18(15-7-4-3-5-8-15)20(27)25-11-12-29-21-24-23-19(26(21)25)14-28-17-10-6-9-16(22)13-17/h3-10,13,18H,2,11-12,14H2,1H3 |
| InChIKey | ZIPLXQKFPFSRLX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |