C14H14Cl2N4O3S — CID 42688059
1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-methoxyethanone (PubChem CID 42688059) has the molecular formula C14H14Cl2N4O3S and a molecular weight of 389.26 g/mol. Its IUPAC name is 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-methoxyethanone.
| Compound Name | 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 42688059 |
| Molecular Formula | C14H14Cl2N4O3S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 1-[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCSc2nnc(COc3cc(Cl)ccc3Cl)n21 |
| InChI | InChI=1S/C14H14Cl2N4O3S/c1-22-8-13(21)19-4-5-24-14-18-17-12(20(14)19)7-23-11-6-9(15)2-3-10(11)16/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | YEGUICROGLKBFJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |