C19H13Cl2F3N4O2S — CID 42688063
[3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 42688063) has the molecular formula C19H13Cl2F3N4O2S and a molecular weight of 489.31 g/mol. Its IUPAC name is [3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 42688063 |
| Molecular Formula | C19H13Cl2F3N4O2S |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | [3-[(2,5-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCSc2nnc(COc3cc(Cl)ccc3Cl)n21 |
| InChI | InChI=1S/C19H13Cl2F3N4O2S/c20-11-5-6-14(21)15(9-11)30-10-16-25-26-18-28(16)27(7-8-31-18)17(29)12-3-1-2-4-13(12)19(22,23)24/h1-6,9H,7-8,10H2 |
| InChIKey | CKCROTSAZOQRRT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |